C27H24N2O6 — CID 53473073
methyl 4-[(E)-[(4-methoxycarbonylphenyl)-[(E)-(4-methoxycarbonylphenyl)methylideneamino]methyl]iminomethyl]benzoate (PubChem CID 53473073) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is methyl 4-[(E)-[(4-methoxycarbonylphenyl)-[(E)-(4-methoxycarbonylphenyl)methylideneamino]methyl]iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-[(4-methoxycarbonylphenyl)-[(E)-(4-methoxycarbonylphenyl)methylideneamino]methyl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 53473073 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | methyl 4-[(E)-[(4-methoxycarbonylphenyl)-[(E)-(4-methoxycarbonylphenyl)methylideneamino]methyl]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/C(/N=C/c2ccc(C(=O)OC)cc2)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O6/c1-33-25(30)21-8-4-18(5-9-21)16-28-24(20-12-14-23(15-13-20)27(32)35-3)29-17-19-6-10-22(11-7-19)26(31)34-2/h4-17,24H,1-3H3/b28-16+,29-17+ |
| InChIKey | IDTAMGFHYYAJDR-LPHFKDDMSA-N |
| XLogP | 4.28 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|