C22H24N4O7 — CID 40879838
methyl 4-[(Z)-[[2-[2-[(2Z)-2-[[4-[(R)-hydroxy(methoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxoethoxy]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 40879838) has the molecular formula C22H24N4O7 and a molecular weight of 456.46 g/mol. Its IUPAC name is methyl 4-[(Z)-[[2-[2-[(2Z)-2-[[4-[(R)-hydroxy(methoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxoethoxy]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[2-[2-[(2Z)-2-[[4-[(R)-hydroxy(methoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxoethoxy]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 40879838 |
| Molecular Formula | C22H24N4O7 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | methyl 4-[(Z)-[[2-[2-[(2Z)-2-[[4-[(R)-hydroxy(methoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxoethoxy]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)COCC(=O)N/N=C\c2ccc([C@H](O)OC)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O7/c1-31-21(29)17-7-3-15(4-8-17)11-23-25-19(27)13-33-14-20(28)26-24-12-16-5-9-18(10-6-16)22(30)32-2/h3-12,21,29H,13-14H2,1-2H3,(H,25,27)(H,26,28)/b23-11-,24-12-/t21-/m1/s1 |
| InChIKey | RGSRNAFFFUTEEW-KJLUCYSNSA-N |
| XLogP | 0.73 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|