C13H17N3O2S — CID 2398118
methyl 4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]benzoate (PubChem CID 2398118) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is methyl 4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]benzoate.
| Compound Name | methyl 4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 2398118 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | methyl 4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=S)NC(C)C)cc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-9(2)15-13(19)16-14-8-10-4-6-11(7-5-10)12(17)18-3/h4-9H,1-3H3,(H2,15,16,19) |
| InChIKey | KSDMLZFPVRQKSY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|