C19H21N3O4S — CID 168536255
methyl 4-[3-[4-[(carbamothioylhydrazinylidene)methyl]phenoxy]propoxy]benzoate (PubChem CID 168536255) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl 4-[3-[4-[(carbamothioylhydrazinylidene)methyl]phenoxy]propoxy]benzoate.
| Compound Name | methyl 4-[3-[4-[(carbamothioylhydrazinylidene)methyl]phenoxy]propoxy]benzoate |
|---|---|
| PubChem CID | 168536255 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 4-[3-[4-[(carbamothioylhydrazinylidene)methyl]phenoxy]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCOc2ccc(C=NNC(N)=S)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-24-18(23)15-5-9-17(10-6-15)26-12-2-11-25-16-7-3-14(4-8-16)13-21-22-19(20)27/h3-10,13H,2,11-12H2,1H3,(H3,20,22,27) |
| InChIKey | XDFFGICFNURFRI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|