C11H13N3O2S — CID 168535389
[4-[(carbamothioylhydrazinylidene)methyl]phenyl] propanoate (PubChem CID 168535389) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is [4-[(carbamothioylhydrazinylidene)methyl]phenyl] propanoate.
| Compound Name | [4-[(carbamothioylhydrazinylidene)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 168535389 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | [4-[(carbamothioylhydrazinylidene)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C=NNC(N)=S)cc1 |
| InChI | InChI=1S/C11H13N3O2S/c1-2-10(15)16-9-5-3-8(4-6-9)7-13-14-11(12)17/h3-7H,2H2,1H3,(H3,12,14,17) |
| InChIKey | RCKDNGKTFJMZEH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|