C13H12N4O4S2 — CID 162668932
[4-[(E)-(carbamothioylhydrazinylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate (PubChem CID 162668932) has the molecular formula C13H12N4O4S2 and a molecular weight of 352.40 g/mol. Its IUPAC name is [4-[(E)-(carbamothioylhydrazinylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate.
| Compound Name | [4-[(E)-(carbamothioylhydrazinylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
|---|---|
| PubChem CID | 162668932 |
| Molecular Formula | C13H12N4O4S2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [4-[(E)-(carbamothioylhydrazinylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
| SMILES | NC(=S)N/N=C/c1ccc(OC(=O)CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C13H12N4O4S2/c14-12(22)17-15-6-7-1-3-8(4-2-7)21-10(18)5-9-11(19)16-13(20)23-9/h1-4,6,9H,5H2,(H3,14,17,22)(H,16,19,20)/b15-6+ |
| InChIKey | CFCNIFGFZNIWDC-GIDUJCDVSA-N |
| XLogP | 0.50 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|