C22H23N3O5S — CID 45108925
tert-butyl [4-[(E)-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]hydrazinylidene]methyl]phenyl] carbonate (PubChem CID 45108925) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is tert-butyl [4-[(E)-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]hydrazinylidene]methyl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[(E)-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]hydrazinylidene]methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 45108925 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tert-butyl [4-[(E)-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]hydrazinylidene]methyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(/C=N/NC(=O)CC2Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-22(2,3)30-21(28)29-15-10-8-14(9-11-15)13-23-25-19(26)12-18-20(27)24-16-6-4-5-7-17(16)31-18/h4-11,13,18H,12H2,1-3H3,(H,24,27)(H,25,26)/b23-13+ |
| InChIKey | DXMQYWVOQZZTJN-YDZHTSKRSA-N |
| XLogP | 3.95 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|