C19H19N3O2S — CID 42666514
N-[(E)-(2,5-dimethylphenyl)methylideneamino]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 42666514) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethylphenyl)methylideneamino]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
| Compound Name | N-[(E)-(2,5-dimethylphenyl)methylideneamino]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 42666514 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(E)-(2,5-dimethylphenyl)methylideneamino]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | Cc1ccc(C)c(/C=N/NC(=O)CC2Sc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C19H19N3O2S/c1-12-7-8-13(2)14(9-12)11-20-22-18(23)10-17-19(24)21-15-5-3-4-6-16(15)25-17/h3-9,11,17H,10H2,1-2H3,(H,21,24)(H,22,23)/b20-11+ |
| InChIKey | WKBHWPKQRFHFBS-RGVLZGJSSA-N |
| XLogP | 3.26 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|