C22H14BrNO6S — CID 35581307
[4-[(E)-[5-(4-bromophenyl)-2-oxofuran-3-ylidene]methyl]phenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 35581307) has the molecular formula C22H14BrNO6S and a molecular weight of 500.33 g/mol. Its IUPAC name is [4-[(E)-[5-(4-bromophenyl)-2-oxofuran-3-ylidene]methyl]phenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | [4-[(E)-[5-(4-bromophenyl)-2-oxofuran-3-ylidene]methyl]phenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 35581307 |
| Molecular Formula | C22H14BrNO6S |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | [4-[(E)-[5-(4-bromophenyl)-2-oxofuran-3-ylidene]methyl]phenyl] 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C(C[C@@H]1SC(=O)NC1=O)Oc1ccc(/C=C2\C=C(c3ccc(Br)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C22H14BrNO6S/c23-15-5-3-13(4-6-15)17-10-14(21(27)30-17)9-12-1-7-16(8-2-12)29-19(25)11-18-20(26)24-22(28)31-18/h1-10,18H,11H2,(H,24,26,28)/b14-9+/t18-/m0/s1 |
| InChIKey | AIIMCGSQNUUMRD-MXHVWWQHSA-N |
| XLogP | 4.08 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|