C15H10N2O5S3 — CID 16627412
[3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate (PubChem CID 16627412) has the molecular formula C15H10N2O5S3 and a molecular weight of 394.46 g/mol. Its IUPAC name is [3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate.
| Compound Name | [3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
|---|---|
| PubChem CID | 16627412 |
| Molecular Formula | C15H10N2O5S3 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | [3-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetate |
| SMILES | O=C(CC1SC(=O)NC1=O)Oc1cccc(/C=C2\SC(=S)NC2=O)c1 |
| InChI | InChI=1S/C15H10N2O5S3/c18-11(6-10-12(19)16-14(21)24-10)22-8-3-1-2-7(4-8)5-9-13(20)17-15(23)25-9/h1-5,10H,6H2,(H,16,19,21)(H,17,20,23)/b9-5- |
| InChIKey | LSQXFNOTHDHXDH-UITAMQMPSA-N |
| XLogP | 1.82 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|