C21H19NO5S2 — CID 139661512
ethyl 2-[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenoxy]acetate (PubChem CID 139661512) has the molecular formula C21H19NO5S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139661512 |
| Molecular Formula | C21H19NO5S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | ethyl 2-[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(COc2cccc(C=C3SC(=S)NC3=O)c2)cc1 |
| InChI | InChI=1S/C21H19NO5S2/c1-2-25-19(23)13-27-16-8-6-14(7-9-16)12-26-17-5-3-4-15(10-17)11-18-20(24)22-21(28)29-18/h3-11H,2,12-13H2,1H3,(H,22,24,28) |
| InChIKey | GXAAAGKXWKBHKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|