C14H19N3O2S — CID 6378083
methyl 4-[(Z)-(butylcarbamothioylhydrazinylidene)methyl]benzoate (PubChem CID 6378083) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is methyl 4-[(Z)-(butylcarbamothioylhydrazinylidene)methyl]benzoate.
| Compound Name | methyl 4-[(Z)-(butylcarbamothioylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 6378083 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | methyl 4-[(Z)-(butylcarbamothioylhydrazinylidene)methyl]benzoate |
| SMILES | CCCCNC(=S)N/N=C\c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H19N3O2S/c1-3-4-9-15-14(20)17-16-10-11-5-7-12(8-6-11)13(18)19-2/h5-8,10H,3-4,9H2,1-2H3,(H2,15,17,20)/b16-10- |
| InChIKey | WDOMOWYEQXEFEF-YBEGLDIGSA-N |
| XLogP | 2.07 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|