C14H18N4OS — CID 9216342
1-butyl-3-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]thiourea (PubChem CID 9216342) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-butyl-3-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]thiourea.
| Compound Name | 1-butyl-3-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 9216342 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-butyl-3-[(Z)-[4-(cyanomethoxy)phenyl]methylideneamino]thiourea |
| SMILES | CCCCNC(=S)N/N=C\c1ccc(OCC#N)cc1 |
| InChI | InChI=1S/C14H18N4OS/c1-2-3-9-16-14(20)18-17-11-12-4-6-13(7-5-12)19-10-8-15/h4-7,11H,2-3,9-10H2,1H3,(H2,16,18,20)/b17-11- |
| InChIKey | OSBBZXXXXWOZBR-BOPFTXTBSA-N |
| XLogP | 2.19 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|