C19H17NO5 — CID 87528511
(E)-3-[4-[(E)-(4-methoxycarbonylphenyl)methoxyiminomethyl]phenyl]prop-2-enoic acid (PubChem CID 87528511) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is (E)-3-[4-[(E)-(4-methoxycarbonylphenyl)methoxyiminomethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-(4-methoxycarbonylphenyl)methoxyiminomethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87528511 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (E)-3-[4-[(E)-(4-methoxycarbonylphenyl)methoxyiminomethyl]phenyl]prop-2-enoic acid |
| SMILES | COC(=O)c1ccc(CO/N=C/c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H17NO5/c1-24-19(23)17-9-6-16(7-10-17)13-25-20-12-15-4-2-14(3-5-15)8-11-18(21)22/h2-12H,13H2,1H3,(H,21,22)/b11-8+,20-12+ |
| InChIKey | QXCXUDXTNACKLN-JOESBUEISA-N |
| XLogP | 3.12 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|