C19H16N2O6 — CID 140526727
4-O-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylideneamino] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 140526727) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is 4-O-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylideneamino] 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylideneamino] 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 140526727 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 4-O-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylideneamino] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)ON=Cc2ccc(/C=C/C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C19H16N2O6/c1-26-18(23)15-7-9-16(10-8-15)19(24)27-20-12-14-4-2-13(3-5-14)6-11-17(22)21-25/h2-12,25H,1H3,(H,21,22)/b11-6+,20-12? |
| InChIKey | QSUIAHLVFPSQHK-XGTXUTLRSA-N |
| XLogP | 2.18 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|