About ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate
ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate (PubChem CID 143594919) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate.
Molecular Properties
| Compound Name | ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate |
| PubChem CID | 143594919 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate |
| SMILES | CC.COc1ccc(C(=O)O/N=C/c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H13NO4.C2H6/c1-19-14-8-4-12(5-9-14)15(18)20-16-10-11-2-6-13(17)7-3-11;1-2/h2-10,17H,1H3;1-2H3/b16-10+; |
| InChIKey | AHAWHHSAJNXPHE-QFHYWFJHSA-N |
| XLogP | 3.62 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate?
The IUPAC name of ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate (CID 143594919) is ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate.
What is the SMILES notation for ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate?
The canonical SMILES for ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate is CC.COc1ccc(C(=O)O/N=C/c2ccc(O)cc2)cc1.
What is the InChIKey of ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate?
The InChIKey is AHAWHHSAJNXPHE-QFHYWFJHSA-N. The full InChI is InChI=1S/C15H13NO4.C2H6/c1-19-14-8-4-12(5-9-14)15(18)20-16-10-11-2-6-13(17)7-3-11;1-2/h2-10,17H,1H3;1-2H3/b16-10+;.
What are the key properties of ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate?
ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate has a molecular weight of 301.34 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(E)-(4-hydroxyphenyl)methylideneamino] 4-methoxybenzoate is sourced from PubChem (CID 143594919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).