About [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate
[(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate (PubChem CID 6873737) has the molecular formula C16H14ClNO3
and a molecular weight of 303.75 g/mol. Its IUPAC name is [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate |
| PubChem CID | 6873737 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate |
| SMILES | CCOc1ccc(/C=N/OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H14ClNO3/c1-2-20-15-9-3-12(4-10-15)11-18-21-16(19)13-5-7-14(17)8-6-13/h3-11H,2H2,1H3/b18-11+ |
| InChIKey | WBZNHKNWWOMFKZ-WOJGMQOQSA-N |
| XLogP | 3.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate?
The IUPAC name of [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate (CID 6873737) is [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate.
What is the SMILES notation for [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate?
The canonical SMILES for [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate is CCOc1ccc(/C=N/OC(=O)c2ccc(Cl)cc2)cc1.
What is the InChIKey of [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate?
The InChIKey is WBZNHKNWWOMFKZ-WOJGMQOQSA-N. The full InChI is InChI=1S/C16H14ClNO3/c1-2-20-15-9-3-12(4-10-15)11-18-21-16(19)13-5-7-14(17)8-6-13/h3-11H,2H2,1H3/b18-11+.
What are the key properties of [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate?
[(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate has a molecular weight of 303.75 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(4-ethoxyphenyl)methylideneamino] 4-chlorobenzoate is sourced from PubChem (CID 6873737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).