C14H19N3O3 — CID 111024014
methyl 4-[[[amino(morpholin-4-yl)methylidene]amino]methyl]benzoate (PubChem CID 111024014) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 4-[[[amino(morpholin-4-yl)methylidene]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[amino(morpholin-4-yl)methylidene]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111024014 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | methyl 4-[[[amino(morpholin-4-yl)methylidene]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C/N=C(\N)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H19N3O3/c1-19-13(18)12-4-2-11(3-5-12)10-16-14(15)17-6-8-20-9-7-17/h2-5H,6-10H2,1H3,(H2,15,16) |
| InChIKey | YKVWCEGPDONCDU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|