C17H29IN4O — CID 111036077
N'-[[4-(diethylaminomethyl)phenyl]methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111036077) has the molecular formula C17H29IN4O and a molecular weight of 432.35 g/mol. Its IUPAC name is N'-[[4-(diethylaminomethyl)phenyl]methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(diethylaminomethyl)phenyl]methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111036077 |
| Molecular Formula | C17H29IN4O |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N'-[[4-(diethylaminomethyl)phenyl]methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN(CC)Cc1ccc(C/N=C(\N)N2CCOCC2)cc1.I |
| InChI | InChI=1S/C17H28N4O.HI/c1-3-20(4-2)14-16-7-5-15(6-8-16)13-19-17(18)21-9-11-22-12-10-21;/h5-8H,3-4,9-14H2,1-2H3,(H2,18,19);1H |
| InChIKey | GKRVTQPSSKPQLP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|