C13H19N3O4 — CID 111859583
ethyl 5-[[[amino(morpholin-4-yl)methylidene]amino]methyl]furan-2-carboxylate (PubChem CID 111859583) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl 5-[[[amino(morpholin-4-yl)methylidene]amino]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[[amino(morpholin-4-yl)methylidene]amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 111859583 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl 5-[[[amino(morpholin-4-yl)methylidene]amino]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C/N=C(\N)N2CCOCC2)o1 |
| InChI | InChI=1S/C13H19N3O4/c1-2-19-12(17)11-4-3-10(20-11)9-15-13(14)16-5-7-18-8-6-16/h3-4H,2,5-9H2,1H3,(H2,14,15) |
| InChIKey | JPCBZAOHJLLANR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|