C15H19ClN2O5 — CID 163269885
ethane;methyl 2-carbamoyl-4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylate (PubChem CID 163269885) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is ethane;methyl 2-carbamoyl-4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylate.
| Compound Name | ethane;methyl 2-carbamoyl-4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylate |
|---|---|
| PubChem CID | 163269885 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | ethane;methyl 2-carbamoyl-4-(2-chloroacetyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylate |
| SMILES | CC.COC(=O)c1ccc2c(c1)OC(C(N)=O)CN2C(=O)CCl |
| InChI | InChI=1S/C13H13ClN2O5.C2H6/c1-20-13(19)7-2-3-8-9(4-7)21-10(12(15)18)6-16(8)11(17)5-14;1-2/h2-4,10H,5-6H2,1H3,(H2,15,18);1-2H3 |
| InChIKey | GPIAHERPTXNIKR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|