C18H19NO3 — CID 143762527
methyl 2-methyl-4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-2H-chromene-6-carboxylate (PubChem CID 143762527) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 2-methyl-4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-2H-chromene-6-carboxylate.
| Compound Name | methyl 2-methyl-4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 143762527 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl 2-methyl-4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-2H-chromene-6-carboxylate |
| SMILES | C=N/C=C\C=C(/C)C1=CC(C)Oc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C18H19NO3/c1-12(6-5-9-19-3)15-10-13(2)22-17-8-7-14(11-16(15)17)18(20)21-4/h5-11,13H,3H2,1-2,4H3/b9-5-,12-6+ |
| InChIKey | XLTFUSYPBIIRFR-JBSCERNYSA-N |
| XLogP | 3.80 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|