C14H14O6 — CID 139792108
methyl 2-(2-hydroxyethyl)-3,5-dioxo-1-benzoxepine-7-carboxylate (PubChem CID 139792108) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 2-(2-hydroxyethyl)-3,5-dioxo-1-benzoxepine-7-carboxylate.
| Compound Name | methyl 2-(2-hydroxyethyl)-3,5-dioxo-1-benzoxepine-7-carboxylate |
|---|---|
| PubChem CID | 139792108 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | methyl 2-(2-hydroxyethyl)-3,5-dioxo-1-benzoxepine-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)CC(=O)C(CCO)O2 |
| InChI | InChI=1S/C14H14O6/c1-19-14(18)8-2-3-12-9(6-8)10(16)7-11(17)13(20-12)4-5-15/h2-3,6,13,15H,4-5,7H2,1H3 |
| InChIKey | WNTDBCQQWQSGIX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|