C15H12O6 — CID 10827176
dimethyl (1R)-2,7-dioxo-1a,7a-dihydro-1H-cyclopropa[b]naphthalene-1,4-dicarboxylate (PubChem CID 10827176) has the molecular formula C15H12O6 and a molecular weight of 288.26 g/mol. Its IUPAC name is dimethyl (1R)-2,7-dioxo-1a,7a-dihydro-1H-cyclopropa[b]naphthalene-1,4-dicarboxylate.
| Compound Name | dimethyl (1R)-2,7-dioxo-1a,7a-dihydro-1H-cyclopropa[b]naphthalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10827176 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | dimethyl (1R)-2,7-dioxo-1a,7a-dihydro-1H-cyclopropa[b]naphthalene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)C1C(C2=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C15H12O6/c1-20-14(18)6-3-4-7-8(5-6)13(17)10-9(12(7)16)11(10)15(19)21-2/h3-5,9-11H,1-2H3/t9?,10?,11-/m1/s1 |
| InChIKey | YZSHYMYCCZPTTB-VQXHTEKXSA-N |
| XLogP | 0.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|