C17H10F2O3 — CID 58553519
8-(2,6-difluoro-3-hydroxyphenyl)naphthalene-2-carboxylic acid (PubChem CID 58553519) has the molecular formula C17H10F2O3 and a molecular weight of 300.26 g/mol. Its IUPAC name is 8-(2,6-difluoro-3-hydroxyphenyl)naphthalene-2-carboxylic acid.
| Compound Name | 8-(2,6-difluoro-3-hydroxyphenyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58553519 |
| Molecular Formula | C17H10F2O3 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 8-(2,6-difluoro-3-hydroxyphenyl)naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cccc(-c3c(F)ccc(O)c3F)c2c1 |
| InChI | InChI=1S/C17H10F2O3/c18-13-6-7-14(20)16(19)15(13)11-3-1-2-9-4-5-10(17(21)22)8-12(9)11/h1-8,20H,(H,21,22) |
| InChIKey | BPPNEQXVKYLUPS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |