methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate

C19H14F2O2 — CID 58553228

IUPACmethyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate
SMILESCOC(=O)c1ccc2cccc(-c3c(F)ccc(F)c3C)c2c1
InChIInChI=1S/C19H14F2O2/c1-11-16(20)8-9-17(21)18(11)14-5-3-4-12-6-7-13(10-15(12)14)19(22)23-2/h3-10H,1-2H3
InChIKeyZJQDWADKQWIPGG-UHFFFAOYSA-N
MW312.32 g/mol
LogP4.88
Rot. Bonds2

About methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate

methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate (PubChem CID 58553228) has the molecular formula C19H14F2O2 and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate.

Molecular Properties

Compound Namemethyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate
PubChem CID58553228
Molecular FormulaC19H14F2O2
Molecular Weight312.32 g/mol
Exact Mass312.10
IUPAC Namemethyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate
SMILESCOC(=O)c1ccc2cccc(-c3c(F)ccc(F)c3C)c2c1
InChIInChI=1S/C19H14F2O2/c1-11-16(20)8-9-17(21)18(11)14-5-3-4-12-6-7-13(10-15(12)14)19(22)23-2/h3-10H,1-2H3
InChIKeyZJQDWADKQWIPGG-UHFFFAOYSA-N
XLogP4.88
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.32
LogP ≤ 54.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate?
The IUPAC name of methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate (CID 58553228) is methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate.
What is the SMILES notation for methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate?
The canonical SMILES for methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate is COC(=O)c1ccc2cccc(-c3c(F)ccc(F)c3C)c2c1.
What is the InChIKey of methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate?
The InChIKey is ZJQDWADKQWIPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2O2/c1-11-16(20)8-9-17(21)18(11)14-5-3-4-12-6-7-13(10-15(12)14)19(22)23-2/h3-10H,1-2H3.
What are the key properties of methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate?
methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate has a molecular weight of 312.32 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-(3,6-difluoro-2-methylphenyl)naphthalene-2-carboxylate is sourced from PubChem (CID 58553228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).