C19H18N2O4 — CID 108804334
methyl 4-[[2-(5,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate (PubChem CID 108804334) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl 4-[[2-(5,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(5,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 108804334 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | methyl 4-[[2-(5,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cc2noc3cc(C)c(C)cc23)cc1 |
| InChI | InChI=1S/C19H18N2O4/c1-11-8-15-16(21-25-17(15)9-12(11)2)10-18(22)20-14-6-4-13(5-7-14)19(23)24-3/h4-9H,10H2,1-3H3,(H,20,22) |
| InChIKey | FLDNDMFHYMZQIV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |