C20H20N2O4 — CID 108794230
ethyl 4-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate (PubChem CID 108794230) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 4-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 108794230 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl 4-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cc2noc3cc(C)cc(C)c23)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-4-25-20(24)14-5-7-15(8-6-14)21-18(23)11-16-19-13(3)9-12(2)10-17(19)26-22-16/h5-10H,4,11H2,1-3H3,(H,21,23) |
| InChIKey | KYURCDSNEOZGRR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |