About methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate
methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate (PubChem CID 171842045) has the molecular formula C20H15Cl2N3O3
and a molecular weight of 416.26 g/mol. Its IUPAC name is methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate |
| PubChem CID | 171842045 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c3nc(Cl)nc(Cl)c3n(Cc3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C20H15Cl2N3O3/c1-27-13-6-3-11(4-7-13)10-25-15-9-12(19(26)28-2)5-8-14(15)16-17(25)18(21)24-20(22)23-16/h3-9H,10H2,1-2H3 |
| InChIKey | UZAZLRRYPHTJRR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate?
The IUPAC name of methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate (CID 171842045) is methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate.
What is the SMILES notation for methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate?
The canonical SMILES for methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate is COC(=O)c1ccc2c3nc(Cl)nc(Cl)c3n(Cc3ccc(OC)cc3)c2c1.
What is the InChIKey of methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate?
The InChIKey is UZAZLRRYPHTJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3O3/c1-27-13-6-3-11(4-7-13)10-25-15-9-12(19(26)28-2)5-8-14(15)16-17(25)18(21)24-20(22)23-16/h3-9H,10H2,1-2H3.
What are the key properties of methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate?
methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate has a molecular weight of 416.26 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dichloro-5-[(4-methoxyphenyl)methyl]pyrimido[5,4-b]indole-7-carboxylate is sourced from PubChem (CID 171842045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).