C26H19ClN4O5 — CID 162694981
methyl 4-chloro-9-[(4-methoxyphenyl)methyl]-2-(3-nitrophenyl)pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 162694981) has the molecular formula C26H19ClN4O5 and a molecular weight of 502.91 g/mol. Its IUPAC name is methyl 4-chloro-9-[(4-methoxyphenyl)methyl]-2-(3-nitrophenyl)pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-chloro-9-[(4-methoxyphenyl)methyl]-2-(3-nitrophenyl)pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 162694981 |
| Molecular Formula | C26H19ClN4O5 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl 4-chloro-9-[(4-methoxyphenyl)methyl]-2-(3-nitrophenyl)pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c3c(Cl)nc(-c4cccc([N+](=O)[O-])c4)nc3n(Cc3ccc(OC)cc3)c2c1 |
| InChI | InChI=1S/C26H19ClN4O5/c1-35-19-9-6-15(7-10-19)14-30-21-13-17(26(32)36-2)8-11-20(21)22-23(27)28-24(29-25(22)30)16-4-3-5-18(12-16)31(33)34/h3-13H,14H2,1-2H3 |
| InChIKey | XVIWTDGXEZDAOE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|