C27H26ClFN2O7 — CID 145438570
6-chloro-5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide (PubChem CID 145438570) has the molecular formula C27H26ClFN2O7 and a molecular weight of 544.96 g/mol. Its IUPAC name is 6-chloro-5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide.
| Compound Name | 6-chloro-5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 145438570 |
| Molecular Formula | C27H26ClFN2O7 |
| Molecular Weight | 544.96 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 6-chloro-5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-3,6-bis(hydroxymethyl)oxan-3-yl]indole-3-carboxamide |
| SMILES | O=C(N[C@@]1(CO)C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)c1cn(Cc2ccc3ccccc3c2)c2cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C27H26ClFN2O7/c28-19-9-21-17(8-20(19)29)18(11-31(21)10-14-5-6-15-3-1-2-4-16(15)7-14)25(36)30-27(13-33)24(35)23(34)22(12-32)38-26(27)37/h1-9,11,22-24,26,32-35,37H,10,12-13H2,(H,30,36)/t22-,23-,24+,26?,27-/m1/s1 |
| InChIKey | RJTMWPQJPOMGCX-QZHNKJQCSA-N |
| XLogP | 1.53 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.96 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |