C22H15Cl3FNO2 — CID 145438568
2,2,2-trichloro-1-[4-fluoro-6-methoxy-1-(naphthalen-2-ylmethyl)indol-3-yl]ethanone (PubChem CID 145438568) has the molecular formula C22H15Cl3FNO2 and a molecular weight of 450.72 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-fluoro-6-methoxy-1-(naphthalen-2-ylmethyl)indol-3-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-fluoro-6-methoxy-1-(naphthalen-2-ylmethyl)indol-3-yl]ethanone |
|---|---|
| PubChem CID | 145438568 |
| Molecular Formula | C22H15Cl3FNO2 |
| Molecular Weight | 450.72 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2,2,2-trichloro-1-[4-fluoro-6-methoxy-1-(naphthalen-2-ylmethyl)indol-3-yl]ethanone |
| SMILES | COc1cc(F)c2c(C(=O)C(Cl)(Cl)Cl)cn(Cc3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C22H15Cl3FNO2/c1-29-16-9-18(26)20-17(21(28)22(23,24)25)12-27(19(20)10-16)11-13-6-7-14-4-2-3-5-15(14)8-13/h2-10,12H,11H2,1H3 |
| InChIKey | AMYPKVODFJPTJM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|