C23H20N2O5 — CID 145438420
6-[2-(methylaminooxy)-2-oxoethoxy]-1-(naphthalen-2-ylmethyl)indole-3-carboxylic acid (PubChem CID 145438420) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 6-[2-(methylaminooxy)-2-oxoethoxy]-1-(naphthalen-2-ylmethyl)indole-3-carboxylic acid.
| Compound Name | 6-[2-(methylaminooxy)-2-oxoethoxy]-1-(naphthalen-2-ylmethyl)indole-3-carboxylic acid |
|---|---|
| PubChem CID | 145438420 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 6-[2-(methylaminooxy)-2-oxoethoxy]-1-(naphthalen-2-ylmethyl)indole-3-carboxylic acid |
| SMILES | CNOC(=O)COc1ccc2c(C(=O)O)cn(Cc3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C23H20N2O5/c1-24-30-22(26)14-29-18-8-9-19-20(23(27)28)13-25(21(19)11-18)12-15-6-7-16-4-2-3-5-17(16)10-15/h2-11,13,24H,12,14H2,1H3,(H,27,28) |
| InChIKey | BGKWZOKHQSDVJI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|