C23H20Cl2N2O3 — CID 123845855
2-[4-[[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]methyl]phenoxy]acetic acid (PubChem CID 123845855) has the molecular formula C23H20Cl2N2O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is 2-[4-[[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 123845855 |
| Molecular Formula | C23H20Cl2N2O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[4-[[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CN2CN(Cc3ccc4ccccc4c3)C(Cl)=C2Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O3/c24-22-23(25)27(13-17-5-8-18-3-1-2-4-19(18)11-17)15-26(22)12-16-6-9-20(10-7-16)30-14-21(28)29/h1-11H,12-15H2,(H,28,29) |
| InChIKey | JVDHFZUHIIBNHF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|