C19H22Cl2N2 — CID 123515469
4,5-dichloro-1-(naphthalen-2-ylmethyl)-3-pentyl-2H-imidazole (PubChem CID 123515469) has the molecular formula C19H22Cl2N2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 4,5-dichloro-1-(naphthalen-2-ylmethyl)-3-pentyl-2H-imidazole.
| Compound Name | 4,5-dichloro-1-(naphthalen-2-ylmethyl)-3-pentyl-2H-imidazole |
|---|---|
| PubChem CID | 123515469 |
| Molecular Formula | C19H22Cl2N2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4,5-dichloro-1-(naphthalen-2-ylmethyl)-3-pentyl-2H-imidazole |
| SMILES | CCCCCN1CN(Cc2ccc3ccccc3c2)C(Cl)=C1Cl |
| InChI | InChI=1S/C19H22Cl2N2/c1-2-3-6-11-22-14-23(19(21)18(22)20)13-15-9-10-16-7-4-5-8-17(16)12-15/h4-5,7-10,12H,2-3,6,11,13-14H2,1H3 |
| InChIKey | JJGPWMKAHOFUTC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|