C15H15Cl2IN2 — CID 70982518
4,5-dichloro-1-methyl-3-(naphthalen-2-ylmethyl)-1,2-dihydroimidazol-1-ium iodide (PubChem CID 70982518) has the molecular formula C15H15Cl2IN2 and a molecular weight of 421.11 g/mol. Its IUPAC name is 4,5-dichloro-1-methyl-3-(naphthalen-2-ylmethyl)-1,2-dihydroimidazol-1-ium iodide.
| Compound Name | 4,5-dichloro-1-methyl-3-(naphthalen-2-ylmethyl)-1,2-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 70982518 |
| Molecular Formula | C15H15Cl2IN2 |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 4,5-dichloro-1-methyl-3-(naphthalen-2-ylmethyl)-1,2-dihydroimidazol-1-ium iodide |
| SMILES | C[NH+]1CN(Cc2ccc3ccccc3c2)C(Cl)=C1Cl.[I-] |
| InChI | InChI=1S/C15H14Cl2N2.HI/c1-18-10-19(15(17)14(18)16)9-11-6-7-12-4-2-3-5-13(12)8-11;/h2-8H,9-10H2,1H3;1H |
| InChIKey | HZCXVJNULGTSRD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|