C19H20Cl2N2O2 — CID 123430379
5-[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]pentanoic acid (PubChem CID 123430379) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 5-[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]pentanoic acid.
| Compound Name | 5-[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 123430379 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 5-[4,5-dichloro-3-(naphthalen-2-ylmethyl)-2H-imidazol-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CN(Cc2ccc3ccccc3c2)C(Cl)=C1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-18-19(21)23(13-22(18)10-4-3-7-17(24)25)12-14-8-9-15-5-1-2-6-16(15)11-14/h1-2,5-6,8-9,11H,3-4,7,10,12-13H2,(H,24,25) |
| InChIKey | BLSWXAWVIKUYBT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|