C27H27FN2O6 — CID 145438553
5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-3-yl]indole-3-carboxamide (PubChem CID 145438553) has the molecular formula C27H27FN2O6 and a molecular weight of 494.52 g/mol. Its IUPAC name is 5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-3-yl]indole-3-carboxamide.
| Compound Name | 5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-3-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 145438553 |
| Molecular Formula | C27H27FN2O6 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 5-fluoro-1-(naphthalen-2-ylmethyl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)-3-methyloxan-3-yl]indole-3-carboxamide |
| SMILES | C[C@]1(NC(=O)c2cn(Cc3ccc4ccccc4c3)c3ccc(F)cc23)C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H27FN2O6/c1-27(24(33)23(32)22(14-31)36-26(27)35)29-25(34)20-13-30(21-9-8-18(28)11-19(20)21)12-15-6-7-16-4-2-3-5-17(16)10-15/h2-11,13,22-24,26,31-33,35H,12,14H2,1H3,(H,29,34)/t22-,23-,24+,26?,27-/m1/s1 |
| InChIKey | KOLYXKDHIWWFEN-QZHNKJQCSA-N |
| XLogP | 1.90 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |