C27H29BrN2O6 — CID 145438511
5-bromo-N-[2-hydroxy-2-[(2S,4S)-1,4,5-trihydroxypentan-2-yl]oxyethyl]-1-(naphthalen-2-ylmethyl)indole-3-carboxamide (PubChem CID 145438511) has the molecular formula C27H29BrN2O6 and a molecular weight of 557.44 g/mol. Its IUPAC name is 5-bromo-N-[2-hydroxy-2-[(2S,4S)-1,4,5-trihydroxypentan-2-yl]oxyethyl]-1-(naphthalen-2-ylmethyl)indole-3-carboxamide.
| Compound Name | 5-bromo-N-[2-hydroxy-2-[(2S,4S)-1,4,5-trihydroxypentan-2-yl]oxyethyl]-1-(naphthalen-2-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 145438511 |
| Molecular Formula | C27H29BrN2O6 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 5-bromo-N-[2-hydroxy-2-[(2S,4S)-1,4,5-trihydroxypentan-2-yl]oxyethyl]-1-(naphthalen-2-ylmethyl)indole-3-carboxamide |
| SMILES | O=C(NCC(O)O[C@H](CO)C[C@H](O)CO)c1cn(Cc2ccc3ccccc3c2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C27H29BrN2O6/c28-20-7-8-25-23(10-20)24(27(35)29-12-26(34)36-22(16-32)11-21(33)15-31)14-30(25)13-17-5-6-18-3-1-2-4-19(18)9-17/h1-10,14,21-22,26,31-34H,11-13,15-16H2,(H,29,35)/t21-,22-,26?/m0/s1 |
| InChIKey | JZVSNRLMVISCMO-PFXBLUCKSA-N |
| XLogP | 2.77 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|