C28H28BrNO3 — CID 175264593
[5-bromo-1-[(4-propan-2-ylphenyl)methyl]indol-3-yl]-phenylmethanone;ethyl formate (PubChem CID 175264593) has the molecular formula C28H28BrNO3 and a molecular weight of 506.44 g/mol. Its IUPAC name is [5-bromo-1-[(4-propan-2-ylphenyl)methyl]indol-3-yl]-phenylmethanone;ethyl formate.
| Compound Name | [5-bromo-1-[(4-propan-2-ylphenyl)methyl]indol-3-yl]-phenylmethanone;ethyl formate |
|---|---|
| PubChem CID | 175264593 |
| Molecular Formula | C28H28BrNO3 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | [5-bromo-1-[(4-propan-2-ylphenyl)methyl]indol-3-yl]-phenylmethanone;ethyl formate |
| SMILES | CC(C)c1ccc(Cn2cc(C(=O)c3ccccc3)c3cc(Br)ccc32)cc1.CCOC=O |
| InChI | InChI=1S/C25H22BrNO.C3H6O2/c1-17(2)19-10-8-18(9-11-19)15-27-16-23(22-14-21(26)12-13-24(22)27)25(28)20-6-4-3-5-7-20;1-2-5-3-4/h3-14,16-17H,15H2,1-2H3;3H,2H2,1H3 |
| InChIKey | KZMISGFBXZUALO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|