C53H42ClN3O4 — CID 160687430
(5-amino-1-benzylindol-3-yl)-phenylmethanone;methyl 2-[(3-benzoyl-1-benzylindol-5-yl)methyl]-5-chlorobenzoate (PubChem CID 160687430) has the molecular formula C53H42ClN3O4 and a molecular weight of 820.39 g/mol. Its IUPAC name is (5-amino-1-benzylindol-3-yl)-phenylmethanone;methyl 2-[(3-benzoyl-1-benzylindol-5-yl)methyl]-5-chlorobenzoate.
| Compound Name | (5-amino-1-benzylindol-3-yl)-phenylmethanone;methyl 2-[(3-benzoyl-1-benzylindol-5-yl)methyl]-5-chlorobenzoate |
|---|---|
| PubChem CID | 160687430 |
| Molecular Formula | C53H42ClN3O4 |
| Molecular Weight | 820.39 g/mol |
| Exact Mass | 819.29 |
| IUPAC Name | (5-amino-1-benzylindol-3-yl)-phenylmethanone;methyl 2-[(3-benzoyl-1-benzylindol-5-yl)methyl]-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1Cc1ccc2c(c1)c(C(=O)c1ccccc1)cn2Cc1ccccc1.Nc1ccc2c(c1)c(C(=O)c1ccccc1)cn2Cc1ccccc1 |
| InChI | InChI=1S/C31H24ClNO3.C22H18N2O/c1-36-31(35)26-18-25(32)14-13-24(26)16-22-12-15-29-27(17-22)28(30(34)23-10-6-3-7-11-23)20-33(29)19-21-8-4-2-5-9-21;23-18-11-12-21-19(13-18)20(22(25)17-9-5-2-6-10-17)15-24(21)14-16-7-3-1-4-8-16/h2-15,17-18,20H,16,19H2,1H3;1-13,15H,14,23H2 |
| InChIKey | ROYHSOAJWLPSAU-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.39 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|