C23H18ClNO2 — CID 157427353
2-[(1-benzylindol-5-yl)methyl]-5-chlorobenzoic acid (PubChem CID 157427353) has the molecular formula C23H18ClNO2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 2-[(1-benzylindol-5-yl)methyl]-5-chlorobenzoic acid.
| Compound Name | 2-[(1-benzylindol-5-yl)methyl]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 157427353 |
| Molecular Formula | C23H18ClNO2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[(1-benzylindol-5-yl)methyl]-5-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1Cc1ccc2c(ccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H18ClNO2/c24-20-8-7-18(21(14-20)23(26)27)12-17-6-9-22-19(13-17)10-11-25(22)15-16-4-2-1-3-5-16/h1-11,13-14H,12,15H2,(H,26,27) |
| InChIKey | LDIHJDFEEGVANJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |