C22H15ClFNO2 — CID 159373042
5-chloro-2-[[1-(4-fluorophenyl)indol-5-yl]methyl]benzoic acid (PubChem CID 159373042) has the molecular formula C22H15ClFNO2 and a molecular weight of 379.82 g/mol. Its IUPAC name is 5-chloro-2-[[1-(4-fluorophenyl)indol-5-yl]methyl]benzoic acid.
| Compound Name | 5-chloro-2-[[1-(4-fluorophenyl)indol-5-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 159373042 |
| Molecular Formula | C22H15ClFNO2 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 5-chloro-2-[[1-(4-fluorophenyl)indol-5-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1Cc1ccc2c(ccn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H15ClFNO2/c23-17-3-2-15(20(13-17)22(26)27)11-14-1-8-21-16(12-14)9-10-25(21)19-6-4-18(24)5-7-19/h1-10,12-13H,11H2,(H,26,27) |
| InChIKey | YUWPHVRMWXFQLC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |