C24H21ClN4O3 — CID 158840079
5-chloro-2-[[1-(2-morpholin-4-ylpyrimidin-4-yl)indol-5-yl]methyl]benzoic acid (PubChem CID 158840079) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is 5-chloro-2-[[1-(2-morpholin-4-ylpyrimidin-4-yl)indol-5-yl]methyl]benzoic acid.
| Compound Name | 5-chloro-2-[[1-(2-morpholin-4-ylpyrimidin-4-yl)indol-5-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 158840079 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 5-chloro-2-[[1-(2-morpholin-4-ylpyrimidin-4-yl)indol-5-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1Cc1ccc2c(ccn2-c2ccnc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C24H21ClN4O3/c25-19-3-2-17(20(15-19)23(30)31)13-16-1-4-21-18(14-16)6-8-29(21)22-5-7-26-24(27-22)28-9-11-32-12-10-28/h1-8,14-15H,9-13H2,(H,30,31) |
| InChIKey | SCWHEUPGNXSIRE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |