C24H19BrClNO2 — CID 159752116
methyl 2-[[1-[(3-bromophenyl)methyl]indol-5-yl]methyl]-5-chlorobenzoate (PubChem CID 159752116) has the molecular formula C24H19BrClNO2 and a molecular weight of 468.78 g/mol. Its IUPAC name is methyl 2-[[1-[(3-bromophenyl)methyl]indol-5-yl]methyl]-5-chlorobenzoate.
| Compound Name | methyl 2-[[1-[(3-bromophenyl)methyl]indol-5-yl]methyl]-5-chlorobenzoate |
|---|---|
| PubChem CID | 159752116 |
| Molecular Formula | C24H19BrClNO2 |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | methyl 2-[[1-[(3-bromophenyl)methyl]indol-5-yl]methyl]-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1Cc1ccc2c(ccn2Cc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C24H19BrClNO2/c1-29-24(28)22-14-21(26)7-6-18(22)11-16-5-8-23-19(12-16)9-10-27(23)15-17-3-2-4-20(25)13-17/h2-10,12-14H,11,15H2,1H3 |
| InChIKey | RLXGEJDMESYLGN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |