C23H21N3O2S — CID 159133612
methyl 5-[(1-benzylindol-5-yl)methyl]-2-methylsulfanylpyrimidine-4-carboxylate (PubChem CID 159133612) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is methyl 5-[(1-benzylindol-5-yl)methyl]-2-methylsulfanylpyrimidine-4-carboxylate.
| Compound Name | methyl 5-[(1-benzylindol-5-yl)methyl]-2-methylsulfanylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 159133612 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | methyl 5-[(1-benzylindol-5-yl)methyl]-2-methylsulfanylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(SC)ncc1Cc1ccc2c(ccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O2S/c1-28-22(27)21-19(14-24-23(25-21)29-2)13-17-8-9-20-18(12-17)10-11-26(20)15-16-6-4-3-5-7-16/h3-12,14H,13,15H2,1-2H3 |
| InChIKey | MJPMPKRKDINJNV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |