C40H38N4O2 — CID 158011491
1-benzylindol-5-amine;methyl 2-[(1-benzylindol-5-yl)methyl]-5-ethylpyridine-3-carboxylate (PubChem CID 158011491) has the molecular formula C40H38N4O2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 1-benzylindol-5-amine;methyl 2-[(1-benzylindol-5-yl)methyl]-5-ethylpyridine-3-carboxylate.
| Compound Name | 1-benzylindol-5-amine;methyl 2-[(1-benzylindol-5-yl)methyl]-5-ethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 158011491 |
| Molecular Formula | C40H38N4O2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 1-benzylindol-5-amine;methyl 2-[(1-benzylindol-5-yl)methyl]-5-ethylpyridine-3-carboxylate |
| SMILES | CCc1cnc(Cc2ccc3c(ccn3Cc3ccccc3)c2)c(C(=O)OC)c1.Nc1ccc2c(ccn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O2.C15H14N2/c1-3-18-14-22(25(28)29-2)23(26-16-18)15-20-9-10-24-21(13-20)11-12-27(24)17-19-7-5-4-6-8-19;16-14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h4-14,16H,3,15,17H2,1-2H3;1-10H,11,16H2 |
| InChIKey | FEXZTXLRKRYMJA-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|