C15H17NO3 — CID 66175171
N-(2,3-dihydroxypropyl)-2-naphthalen-2-ylacetamide (PubChem CID 66175171) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 66175171 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)NCC(O)CO |
| InChI | InChI=1S/C15H17NO3/c17-10-14(18)9-16-15(19)8-11-5-6-12-3-1-2-4-13(12)7-11/h1-7,14,17-18H,8-10H2,(H,16,19) |
| InChIKey | AWNKGQLRNGBSSG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |