C11H16N2O4 — CID 69439974
2-(4-amino-3-hydroxyphenyl)-N-(2,3-dihydroxypropyl)acetamide (PubChem CID 69439974) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(4-amino-3-hydroxyphenyl)-N-(2,3-dihydroxypropyl)acetamide.
| Compound Name | 2-(4-amino-3-hydroxyphenyl)-N-(2,3-dihydroxypropyl)acetamide |
|---|---|
| PubChem CID | 69439974 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(4-amino-3-hydroxyphenyl)-N-(2,3-dihydroxypropyl)acetamide |
| SMILES | Nc1ccc(CC(=O)NCC(O)CO)cc1O |
| InChI | InChI=1S/C11H16N2O4/c12-9-2-1-7(3-10(9)16)4-11(17)13-5-8(15)6-14/h1-3,8,14-16H,4-6,12H2,(H,13,17) |
| InChIKey | VHWBAGRGUQCZNR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|