C10H14N2O3 — CID 69305950
2-(4-amino-3-hydroxyphenyl)-N-(2-hydroxyethyl)acetamide (PubChem CID 69305950) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4-amino-3-hydroxyphenyl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(4-amino-3-hydroxyphenyl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 69305950 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(4-amino-3-hydroxyphenyl)-N-(2-hydroxyethyl)acetamide |
| SMILES | Nc1ccc(CC(=O)NCCO)cc1O |
| InChI | InChI=1S/C10H14N2O3/c11-8-2-1-7(5-9(8)14)6-10(15)12-3-4-13/h1-2,5,13-14H,3-4,6,11H2,(H,12,15) |
| InChIKey | OIJBOLYEENNVPT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|